Compound Q&A

How should 5-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800401-84-7) be stored?

Answer

5-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
5-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent degradation and contamination. Storage at room temperature is recommended, but it is best to check the specific storage conditions provided by the manufacturer.

About

English Name 5-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
Molecular Formula C8H5ClN2O2
Molecular Weight 196.59 g/mol
SMILES C1=C2C=C(NC2=NC=C1Cl)C(=O)O
InChIKey YMSGAOPCRLRFMT-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is 5-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800401-84-7)?

5-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid, also known as 5-Cl-PPCA, is a chemical compoun...

Compound Q&A

What are the main uses of 5-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800401-84-7)?

5-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (5-Cl-PPCA) is primarily used in the pharmaceut...

Compound Q&A

Is 5-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 800401-84-7) safe?

5-Chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is generally safe when handled with proper prec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...