Compound Q&A

What are the main uses of 5-Chloro-3-nitro-2-pyridinecarbonitrile (CAS: 181123-11-5)?

Answer

5-Chloro-3-nitro-2-pyridinecarbonitrile
5-Chloro-3-nitro-2-pyridinecarbonitrile (CAS: 181123-11-5) is primarily used as an intermediate in the synthesis of pharmaceuticals, particularly in the development of certain antiviral and anticancer drugs. It also serves as a reagent in organic synthesis and is used in some industrial processes.

About

English Name 5-Chloro-3-nitro-2-pyridinecarbonitrile
Molecular Formula C6H2ClN3O2
Molecular Weight 183.55 g/mol
SMILES C1=C(C=NC(=C1[N+](=O)[O-])C#N)Cl
InChIKey UFTRTPYMNGYVGO-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is 5-Chloro-3-nitro-2-pyridinecarbonitrile (CAS: 181123-11-5)?

5-Chloro-3-nitro-2-pyridinecarbonitrile (CAS: 181123-11-5) is a heterocyclic compound with a pyridin...

Compound Q&A

Is 5-Chloro-3-nitro-2-pyridinecarbonitrile (CAS: 181123-11-5) safe?

5-Chloro-3-nitro-2-pyridinecarbonitrile (CAS: 181123-11-5) is not considered inherently dangerous un...

Compound Q&A

How should 5-Chloro-3-nitro-2-pyridinecarbonitrile (CAS: 181123-11-5) be stored?

5-Chloro-3-nitro-2-pyridinecarbonitrile (CAS: 181123-11-5) should be stored in a tightly sealed cont...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...