Compound Q&A

How should Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate (CAS: 147531-11-1) be stored?

Answer

Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate
Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate (CAS: 147531-11-1) should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent exposure to moisture and air. Store it in a well-ventilated area and away from incompatible materials such as acids and alkalis.

About

English Name Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate
Molecular Formula C14H10F6O3S2
Molecular Weight 404.4 g/mol
SMILES C1=CC=C(C=C1)[S+](C2=CC=CC=C2)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[O-]
InChIKey YHEBUXDOUNWVNZ-UHFFFAOYSA-M
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate (CAS: 147531-11-1)?

Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate (CAS: 147531-11-1) is an organic compou...

Compound Q&A

What are the main uses of Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate (CAS: 147531-11-1)?

Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate (CAS: 147531-11-1) is primarily used as...

Compound Q&A

Is Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate (CAS: 147531-11-1) safe?

Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate (CAS: 147531-11-1) is generally conside...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...