Compound Q&A

What are the main uses of (2S)-3-{[(tert-butoxy)carbonyl]amino}-2-methylpropanoic acid (CAS: 190897-47-3)?

Answer

(2S)-3-{[(tert-butoxy)carbonyl]amino}-2-methylpropanoic acid
(2S)-3-{[(tert-butoxy)carbonyl]amino}-2-methylpropanoic acid is primarily used as a protecting group in organic synthesis. It is utilized in the pharmaceutical industry for the synthesis of certain drug candidates, in the chemical industry for the production of various organic compounds, and in research for laboratory experiments and chemical analysis. Its application includes the formation of esters and amides, as well as the protection of amino groups during chemical reactions.

About

English Name (2S)-3-{[(tert-butoxy)carbonyl]amino}-2-methylpropanoic acid
Molecular Formula C9H17NO4
Molecular Weight 203.24 g/mol
SMILES CC(CNC(=O)OC(C)(C)C)C(=O)O
InChIKey GDQRNRYMFXDGMS-LURJTMIESA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is (2S)-3-{[(tert-butoxy)carbonyl]amino}-2-methylpropanoic acid (CAS: 190897-47-3)?

(2S)-3-{[(tert-butoxy)carbonyl]amino}-2-methylpropanoic acid, also known as tert-butyl 2-methyl-2-[(...

Compound Q&A

Is (2S)-3-{[(tert-butoxy)carbonyl]amino}-2-methylpropanoic acid (CAS: 190897-47-3) safe?

(2S)-3-{[(tert-butoxy)carbonyl]amino}-2-methylpropanoic acid is generally considered safe for labora...

Compound Q&A

How should (2S)-3-{[(tert-butoxy)carbonyl]amino}-2-methylpropanoic acid (CAS: 190897-47-3) be stored?

(2S)-3-{[(tert-butoxy)carbonyl]amino}-2-methylpropanoic acid should be stored in a cool, dry place w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...