Compound Q&A

Is 6-Amino-4-(4-phenoxyphenylethylamino)quinazoline (CAS: 545380-34-5) safe?

Answer

6-Amino-4-(4-phenoxyphenylethylamino)quinazoline
6-Amino-4-(4-phenoxyphenylethylamino)quinazoline is generally considered safe when handled with appropriate safety precautions. Users should follow standard safety guidelines, including the use of personal protective equipment, to prevent skin contact and inhalation. Storage and handling should be done in a well-ventilated area, away from heat and open flames.

About

English Name 6-Amino-4-(4-phenoxyphenylethylamino)quinazoline
Molecular Formula C22H20N4O
Molecular Weight 356.4290000000001 g/mol
SMILES C1=CC=C(C=C1)OC2=CC=C(C=C2)CCNC3=NC=NC4=C3C=C(C=C4)N
InChIKey IBAKVEUZKHOWNG-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is 6-Amino-4-(4-phenoxyphenylethylamino)quinazoline (CAS: 545380-34-5)?

6-Amino-4-(4-phenoxyphenylethylamino)quinazoline is a complex organic compound with the CAS number 5...

Compound Q&A

What are the main uses of 6-Amino-4-(4-phenoxyphenylethylamino)quinazoline (CAS: 545380-34-5)?

6-Amino-4-(4-phenoxyphenylethylamino)quinazoline is primarily used as an intermediate in the synthes...

Compound Q&A

How should 6-Amino-4-(4-phenoxyphenylethylamino)quinazoline (CAS: 545380-34-5) be stored?

6-Amino-4-(4-phenoxyphenylethylamino)quinazoline should be stored in a cool, dry place, protected fr...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...