Compound Q&A

What are the main uses of 3-(Dihydroxyboryl)-5-nitrobenzoic acid (CAS: 101084-81-5)?

Answer

3-(Dihydroxyboryl)-5-nitrobenzoic acid
3-(Dihydroxyboryl)-5-nitrobenzoic acid is primarily used in research and pharmaceutical applications. It serves as a precursor in the synthesis of other compounds and has potential applications in the development of new drugs and materials. Additionally, it may be used in analytical chemistry for specific reagent purposes.

About

English Name 3-(Dihydroxyboryl)-5-nitrobenzoic acid
Molecular Formula C7H6BNO6
Molecular Weight 210.94 g/mol
SMILES B(C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)O)(O)O
InChIKey WNIFCLWDGNHGMX-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is 3-(Dihydroxyboryl)-5-nitrobenzoic acid (CAS: 101084-81-5)?

3-(Dihydroxyboryl)-5-nitrobenzoic acid is an organic compound with the CAS number 101084-81-5. It is...

Compound Q&A

Is 3-(Dihydroxyboryl)-5-nitrobenzoic acid (CAS: 101084-81-5) safe?

While 3-(Dihydroxyboryl)-5-nitrobenzoic acid is generally considered safe for laboratory use under p...

Compound Q&A

How should 3-(Dihydroxyboryl)-5-nitrobenzoic acid (CAS: 101084-81-5) be stored?

3-(Dihydroxyboryl)-5-nitrobenzoic acid should be stored in a cool, dry place, away from direct sunli...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...