Compound Q&A

What is beta-Alanylhistidine (CAS: 9001-33-6)?

Answer

beta-Alanylhistidine
Beta-Alanylhistidine (CAS: 9001-33-6) is a dipeptide composed of beta-alanine and histidine. It is a colorless or white crystalline powder with a molecular formula of C8H16N4O4. This compound is known for its unique biochemical properties, making it useful in various applications.

About

CAS No 9001-33-6
English Name beta-Alanylhistidine
Molecular Formula C9H14N4O3
Molecular Weight 226.24 g/mol
EINECS 232-599-1
SMILES c1c([nH]cn1)CC(C(=O)O)NC(=O)CCN
InChIKey CQOVPNPJLQNMDC-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What are the main uses of beta-Alanylhistidine (CAS: 9001-33-6)?

Beta-Alanylhistidine (CAS: 9001-33-6) is primarily used in the production of dietary supplements, pa...

Compound Q&A

Is beta-Alanylhistidine (CAS: 9001-33-6) safe?

Beta-Alanylhistidine (CAS: 9001-33-6) is generally considered safe when used as directed. However, i...

Compound Q&A

How should beta-Alanylhistidine (CAS: 9001-33-6) be stored?

Beta-Alanylhistidine (CAS: 9001-33-6) should be stored in a cool, dry place away from direct sunligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...