Compound Q&A

What is 4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tribenzoic acid (CAS: 61414-16-2)?

Answer

4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tribenzoic acid
4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tribenzoic acid, also known as TTB, is a complex organic compound with a triazine core linked to three benzoic acid units. It is characterized by its strong acidic properties and is used in various applications due to its stability and reactivity.

About

CAS No 61414-16-2
English Name 4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tribenzoic acid
Molecular Formula C24H15N3O6
Molecular Weight 441.4 g/mol
SMILES O=C(C1=CC=C(C2=NC(C3=CC=C(C(O)=O)C=C3)=NC(C4=CC=C(C(O)=O)C=C4)=N2)C=C1)O
InChIKey MSFXUHUYNSYIDR-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What are the main uses of 4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tribenzoic acid (CAS: 61414-16-2)?

4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tribenzoic acid is primarily used in the synthesis of other org...

Compound Q&A

Is 4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tribenzoic acid (CAS: 61414-16-2) safe?

4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tribenzoic acid is generally safe when handled with appropriate...

Compound Q&A

How should 4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tribenzoic acid (CAS: 61414-16-2) be stored?

4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tribenzoic acid should be stored in a cool, dry place away from...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...