Compound Q&A

What are the main uses of 1-Benzyl 4-methyl 1,4-piperidinedicarboxylate (CAS: 138163-07-2)?

Answer

1-Benzyl 4-methyl 1,4-piperidinedicarboxylate
1-Benzyl 4-methyl 1,4-piperidinedicarboxylate (CAS: 138163-07-2) is primarily used as a starting material in the synthesis of pharmaceuticals, particularly in the development of analgesics and anti-inflammatory drugs. It also finds applications in polymer chemistry and as a reagent in organic synthesis.

About

English Name 1-Benzyl 4-methyl 1,4-piperidinedicarboxylate
Molecular Formula C15H19NO4
Molecular Weight 277.32 g/mol
SMILES COC(=O)C1CCN(CC1)C(=O)OCC2=CC=CC=C2
InChIKey SLMXUTJFULFSMQ-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is 1-Benzyl 4-methyl 1,4-piperidinedicarboxylate (CAS: 138163-07-2)?

1-Benzyl 4-methyl 1,4-piperidinedicarboxylate (CAS: 138163-07-2) is an organic compound with a molec...

Compound Q&A

Is 1-Benzyl 4-methyl 1,4-piperidinedicarboxylate (CAS: 138163-07-2) safe?

1-Benzyl 4-methyl 1,4-piperidinedicarboxylate (CAS: 138163-07-2) is generally considered safe for la...

Compound Q&A

How should 1-Benzyl 4-methyl 1,4-piperidinedicarboxylate (CAS: 138163-07-2) be stored?

1-Benzyl 4-methyl 1,4-piperidinedicarboxylate (CAS: 138163-07-2) should be stored in a tightly seale...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...