Compound Q&A

What are the main uses of 5-Bromo-1H-indole-3-carboxylic acid (CAS: 10406-06-1)?

Answer

5-Bromo-1H-indole-3-carboxylic acid
5-Bromo-1H-indole-3-carboxylic acid (CAS: 10406-06-1) is primarily used in pharmaceuticals as a precursor for the synthesis of other indole derivatives. It is also utilized in research for biological and chemical studies, particularly in the fields of medicinal chemistry and drug discovery.

About

CAS No 10406-06-1
English Name 5-Bromo-1H-indole-3-carboxylic acid
Molecular Formula C9H6BrNO2
Molecular Weight 240.06 g/mol
SMILES C1=CC2=C(C=C1Br)C(=CN2)C(=O)O
InChIKey JVZMBSGNSAHFCY-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is 5-Bromo-1H-indole-3-carboxylic acid (CAS: 10406-06-1)?

5-Bromo-1H-indole-3-carboxylic acid is an organic compound with the CAS number 10406-06-1. It contai...

Compound Q&A

Is 5-Bromo-1H-indole-3-carboxylic acid (CAS: 10406-06-1) safe?

5-Bromo-1H-indole-3-carboxylic acid (CAS: 10406-06-1) is considered safe when handled with proper pr...

Compound Q&A

How should 5-Bromo-1H-indole-3-carboxylic acid (CAS: 10406-06-1) be stored?

5-Bromo-1H-indole-3-carboxylic acid (CAS: 10406-06-1) should be stored in a tightly sealed container...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...