Compound Q&A

How should 2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride (CAS: 135634-18-3) be stored?

Answer

2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride
2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a closed container to prevent moisture absorption. The storage temperature should be below 25°C (77°F) to maintain its stability and purity.

About

English Name 2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride
Molecular Formula C12H15ClF2N2O
Molecular Weight 276.71 g/mol
SMILES C1CNCCC1C(=NO)C2=C(C=C(C=C2)F)F.Cl
InChIKey CPVWKXXFKMUDPA-PXJKFVASSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is 2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride (CAS: 135634-18-3)?

2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride is a chemical compound with the CAS ...

Compound Q&A

What are the main uses of 2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride (CAS: 135634-18-3)?

2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride is primarily used in the pharmaceuti...

Compound Q&A

Is 2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride (CAS: 135634-18-3) safe?

2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride is generally considered safe when us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...