Compound Q&A

How should 4-(4-Chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine (CAS: 857531-00-1) be stored?

Answer

4-(4-Chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine
4-(4-Chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine should be stored in a cool, dry place at room temperature (15-25°C), away from direct sunlight and heat sources. Use airtight containers to prevent moisture and ensure the integrity of the compound. Keep the storage area ventilated and away from flammable materials.

About

English Name 4-(4-Chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine
Molecular Formula C20H20ClN3
Molecular Weight 337.85 g/mol
SMILES Clc1ccc(cc1)C1(CCNCC1)c1ccc(cc1)c1c[nH]nc1
InChIKey LZMOSYUFVYJEPY-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is 4-(4-Chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine (CAS: 857531-00-1)?

4-(4-Chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine is a complex organic compound with the CA...

Compound Q&A

What are the main uses of 4-(4-Chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine (CAS: 857531-00-1)?

4-(4-Chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine finds applications primarily in pharmaceu...

Compound Q&A

Is 4-(4-Chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine (CAS: 857531-00-1) safe?

4-(4-Chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine is generally considered safe when handled...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...