Compound Q&A

What is 5-Bromo-2-methyl-3-nitrobenzoic acid (CAS: 107650-20-4)?

Answer

5-Bromo-2-methyl-3-nitrobenzoic acid
5-Bromo-2-methyl-3-nitrobenzoic acid (CAS: 107650-20-4) is a colorless solid with a bitter taste. It is a derivative of benzoic acid containing a nitro, bromo, and methyl group. This compound is used in the synthesis of various drugs and as an intermediate in organic chemistry.

About

English Name 5-Bromo-2-methyl-3-nitrobenzoic acid
Molecular Formula C8H6BrNO4
Molecular Weight 260.04 g/mol
SMILES CC1=C(C=C(C=C1[N+](=O)[O-])Br)C(=O)O
InChIKey DXUUJILVHXQDCV-UHFFFAOYSA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What are the main uses of 5-Bromo-2-methyl-3-nitrobenzoic acid (CAS: 107650-20-4)?

5-Bromo-2-methyl-3-nitrobenzoic acid is primarily used in the pharmaceutical industry as an intermed...

Compound Q&A

Is 5-Bromo-2-methyl-3-nitrobenzoic acid (CAS: 107650-20-4) safe?

5-Bromo-2-methyl-3-nitrobenzoic acid is generally safe when handled with appropriate precautions. Ho...

Compound Q&A

How should 5-Bromo-2-methyl-3-nitrobenzoic acid (CAS: 107650-20-4) be stored?

5-Bromo-2-methyl-3-nitrobenzoic acid should be stored in a cool, dry place away from direct sunlight...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...