Compound Q&A

What is tert-butyl 3-(6-amino-3-methyl-2-pyridyl)benzoate (CAS: 1083057-14-0)?

Answer

tert-butyl 3-(6-amino-3-methyl-2-pyridyl)benzoate
tert-butyl 3-(6-amino-3-methyl-2-pyridyl)benzoate (CAS: 1083057-14-0) is an organic compound with a molecular structure that includes a tert-butyl group, a 3-(6-amino-3-methyl-2-pyridyl)benzoate moiety, and a benzene ring. It is a complex aromatic compound with potential applications in pharmaceuticals and research.

About

English Name tert-butyl 3-(6-amino-3-methyl-2-pyridyl)benzoate
Molecular Formula C17H20N2O2
Molecular Weight 284.36 g/mol
SMILES Nc1ccc(c(n1)c1cccc(c1)C(=O)OC(C)(C)C)C
InChIKey RZGNTHQZYZRDDB-UHFFFAOYSA-N
Last Updated: 2025-10-15 11:13

Related Q&A

Compound Q&A

What are the main uses of tert-butyl 3-(6-amino-3-methyl-2-pyridyl)benzoate (CAS: 1083057-14-0)?

tert-butyl 3-(6-amino-3-methyl-2-pyridyl)benzoate (CAS: 1083057-14-0) is primarily used as a resear...

Compound Q&A

Is tert-butyl 3-(6-amino-3-methyl-2-pyridyl)benzoate (CAS: 1083057-14-0) safe?

tert-butyl 3-(6-amino-3-methyl-2-pyridyl)benzoate (CAS: 1083057-14-0) is generally safe when handle...

Compound Q&A

How should tert-butyl 3-(6-amino-3-methyl-2-pyridyl)benzoate (CAS: 1083057-14-0) be stored?

tert-butyl 3-(6-amino-3-methyl-2-pyridyl)benzoate (CAS: 1083057-14-0) should be stored in a cool, d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...