Compound Q&A

Are there alternatives to 4-Fluoro-3-nitrobenzenesulfonamide in synthesis?

Answer

4-Fluoro-3-nitrobenzenesulfonamide
Alternatives to 4-Fluoro-3-nitrobenzenesulfonamide in synthesis include other sulfonamides with similar functional groups, such as 4-chloro-3-nitrobenzenesulfonamide or 4-methoxy-3-nitrobenzenesulfonamide. These can serve as effective substituents in various chemical reactions, depending on the desired outcome and reaction conditions.

About

English Name 4-Fluoro-3-nitrobenzenesulfonamide
Molecular Formula C6H5FN2O4S
Molecular Weight 220.18 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)N)[N+](=O)[O-])F
InChIKey FAYVDRRKPVJSPE-UHFFFAOYSA-N
Last Updated: 2025-10-14 19:01

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-Fluoro-3-nitrobenzenesulfonamide (CAS: 406233-31-6)?

The regulatory guidelines for 4-Fluoro-3-nitrobenzenesulfonamide (CAS: 406233-31-6) include GHS clas...

Compound Q&A

What is the market or research trend for 4-Fluoro-3-nitrobenzenesulfonamide?

The market for 4-Fluoro-3-nitrobenzenesulfonamide is growing due to its applications in pharmaceutic...

Compound Q&A

How should waste containing 4-Fluoro-3-nitrobenzenesulfonamide be handled?

Waste containing 4-Fluoro-3-nitrobenzenesulfonamide should be collected and stored in sealed contain...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...