Compound Q&A

What regulatory guidelines apply to 1-Isopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (CAS: 879487-10-2)?

Answer

1-Isopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
The compound is subject to the REACH regulations in the European Union, requiring registration if used above a certain tonnage threshold. Additionally, the GHS classification must be considered for labeling and safety data sheets. In the US, the FDA and EPA may have specific requirements for its use in certain applications, such as pharmaceuticals or pesticides.

About

English Name 1-Isopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Molecular Formula C12H21BN2O2
Molecular Weight 236.12 g/mol
SMILES B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(C)C
InChIKey OGYYMVGDKVJYSU-UHFFFAOYSA-N
Last Updated: 2025-10-14 19:01

Related Q&A

Compound Q&A

Are there alternatives to 1-Isopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (CAS: 879487-10-2) in synthesis?

Alternative reagents such as 1-isopropyl-4-iodopyrazole or 1-isopropyl-4-bromopyrazole can be used a...

Compound Q&A

What is the market or research trend for 1-Isopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (CAS: 879487-10-2)?

The compound is gaining interest in the pharmaceutical and agrochemical industries due to its potent...

Compound Q&A

How should waste containing 1-Isopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (CAS: 879487-10-2) be handled?

Waste should be collected in appropriate containers and handled according to local regulations. Inci...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...