Compound Q&A

Are there alternatives to 3-bromobenzene-1-carboximidamide hydrochloride (CAS: 16796-52-4) in synthesis?

Answer

3-bromobenzene-1-carboximidamide hydrochloride
There are alternative reagents that can be used in the synthesis of compounds similar to 3-bromobenzene-1-carboximidamide hydrochloride (CAS: 16796-52-4). For example, 3-chlorobenzene-1-carboximidamide hydrochloride or 3-fluorobenzene-1-carboximidamide hydrochloride can be considered. These compounds share similar functional groups and can serve as viable alternatives depending on the specific reaction conditions and desired product.

About

CAS No 16796-52-4
English Name 3-bromobenzene-1-carboximidamide hydrochloride
Molecular Formula C7H8BrClN2
Molecular Weight 235.512 g/mol
SMILES C1=CC(=CC(=C1)Br)C(=N)N.Cl
InChIKey XIZFRYIWRFNILW-UHFFFAOYSA-N
Last Updated: 2025-10-14 19:01

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3-bromobenzene-1-carboximidamide hydrochloride (CAS: 16796-52-4)?

3-bromobenzene-1-carboximidamide hydrochloride (CAS: 16796-52-4) is regulated under the Globally Har...

Compound Q&A

What is the market or research trend for 3-bromobenzene-1-carboximidamide hydrochloride (CAS: 16796-52-4)?

The market for 3-bromobenzene-1-carboximidamide hydrochloride (CAS: 16796-52-4) is characterized by ...

Compound Q&A

How should waste containing 3-bromobenzene-1-carboximidamide hydrochloride (CAS: 16796-52-4) be handled?

Waste containing 3-bromobenzene-1-carboximidamide hydrochloride (CAS: 16796-52-4) should be collecte...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...