Compound Q&A

What is the market or research trend for 3,4-Dimethoxy-2-methylpyridine 1-oxide (CAS: 72830-07-0)?

Answer

3,4-Dimethoxy-2-methylpyridine 1-oxide
The market for 3,4-Dimethoxy-2-methylpyridine 1-oxide (CAS: 72830-07-0) is growing with increasing demand in pharmaceuticals and agrochemicals due to its unique chemical properties. Research trends are focusing on its potential applications in drug synthesis and as a precursor for various organic compounds. Market dynamics include rising prices driven by increased demand and limited supply, particularly in specialized sectors.

About

CAS No 72830-07-0
English Name 3,4-Dimethoxy-2-methylpyridine 1-oxide
Molecular Formula C8H11NO3
Molecular Weight 169.18 g/mol
SMILES CC1=[N+](C=CC(=C1OC)OC)[O-]
InChIKey UMVFRRJTPKYVAY-UHFFFAOYSA-N
Last Updated: 2025-10-14 19:01

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3,4-Dimethoxy-2-methylpyridine 1-oxide (CAS: 72830-07-0)?

3,4-Dimethoxy-2-methylpyridine 1-oxide (CAS: 72830-07-0) falls under various regulatory guidelines s...

Compound Q&A

Are there alternatives to 3,4-Dimethoxy-2-methylpyridine 1-oxide in synthesis (CAS: 72830-07-0)?

While 3,4-Dimethoxy-2-methylpyridine 1-oxide (CAS: 72830-07-0) is a specific compound, there are alt...

Compound Q&A

How should waste containing 3,4-Dimethoxy-2-methylpyridine 1-oxide (CAS: 72830-07-0) be handled?

Waste containing 3,4-Dimethoxy-2-methylpyridine 1-oxide (CAS: 72830-07-0) should be handled accordin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...