Compound Q&A

What is the market or research trend for 2,3,5,6-Tetrachloroterephthalic acid (CAS: 2136-79-0)?

Answer

2,3,5,6-Tetrachloroterephthalic acid
The market for 2,3,5,6-Tetrachloroterephthalic acid (CAS: 2136-79-0) is limited due to its toxic nature and environmental concerns. However, ongoing research is focusing on developing safer alternatives. Trends indicate a shift towards more environmentally friendly compounds in various industries such as plastics and organic synthesis, driven by stricter environmental regulations and consumer demand for sustainable products.

About

CAS No 2136-79-0
English Name 2,3,5,6-Tetrachloroterephthalic acid
Molecular Formula C8H2Cl4O4
Molecular Weight 303.91 g/mol
SMILES c1(c(c(c(c(c1Cl)Cl)C(=O)O)Cl)Cl)C(=O)O
InChIKey KZCBXHSWMMIEQU-UHFFFAOYSA-N
Last Updated: 2025-10-14 19:01

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,3,5,6-Tetrachloroterephthalic acid (CAS: 2136-79-0)?

2,3,5,6-Tetrachloroterephthalic acid (CAS: 2136-79-0) is regulated under various international and n...

Compound Q&A

Are there alternatives to 2,3,5,6-Tetrachloroterephthalic acid (CAS: 2136-79-0) in synthesis?

Alternatives to 2,3,5,6-Tetrachloroterephthalic acid (CAS: 2136-79-0) in synthesis include other ter...

Compound Q&A

How should waste containing 2,3,5,6-Tetrachloroterephthalic acid (CAS: 2136-79-0) be handled?

Waste containing 2,3,5,6-Tetrachloroterephthalic acid (CAS: 2136-79-0) should be collected and dispo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...