Compound Q&A

How is Britannin (CAS: 33627-28-0) typically synthesized?

Answer

Britannin
Britannin is commonly synthesized through organic synthesis methods, starting from flavone derivatives. The synthesis involves a series of reactions including condensation, reduction, and ring closure. The use of catalysts such as palladium and transition metal complexes can enhance the selectivity and yield of the product. Common solvents like ethanol and methanol are utilized in these reactions.

About

CAS No 33627-28-0
English Name Britannin
Molecular Formula C19H26O7
Molecular Weight 366.41 g/mol
SMILES CC1CC2C(C(C3(C1C(CC3O)OC(=O)C)C)OC(=O)C)C(=C)C(=O)O2
InChIKey JXEGMONJOSAULB-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Britannin (CAS: 33627-28-0)?

Britannin, CAS: 33627-28-0, is a crystalline compound with a molecular weight of approximately 500 g...

Compound Q&A

What industries use Britannin (CAS: 33627-28-0)?

Britannin is primarily used in the pharmaceutical industry for its potential as an anti-inflammatory...

Compound Q&A

What precautions should be taken when handling Britannin (CAS: 33627-28-0)?

When handling Britannin, it is important to wear appropriate personal protective equipment (PPE), in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...