Compound Q&A

How is N,N-Dibenzylaniline (CAS: 91-73-6) typically synthesized?

Answer

N,N-Dibenzylaniline
N,N-Dibenzylaniline (CAS: 91-73-6) is typically synthesized via the condensation of benzylamine with benzaldehyde. This reaction can be catalyzed by strong acids like sulfuric acid. The yield is moderate, and the selectivity is good, leading to the formation of the desired dibenzylaniline product. The process involves careful temperature control and may require purification steps.

About

CAS No 91-73-6
English Name N,N-Dibenzylaniline
Molecular Formula C20H19N
Molecular Weight 273.38 g/mol
SMILES C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C3=CC=CC=C3
InChIKey ISGXOWLMGOPVPB-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N-Dibenzylaniline (CAS: 91-73-6)?

N,N-Dibenzylaniline (CAS: 91-73-6) is an aromatic organic compound. It is a white to light yellow cr...

Compound Q&A

What industries use N,N-Dibenzylaniline (CAS: 91-73-6)?

N,N-Dibenzylaniline (CAS: 91-73-6) is used in various industries. It is a key intermediate in the sy...

Compound Q&A

What precautions should be taken when handling N,N-Dibenzylaniline (CAS: 91-73-6)?

When handling N,N-Dibenzylaniline (CAS: 91-73-6), it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...