Compound Q&A

How is 5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2) typically synthesized?

Answer

5,10,15,20-Tetra(4-pyridinyl)porphine
5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2) is typically synthesized by the condensation of four equivalents of 4-pyridinecarboxaldehyde with porphyrinogen. This process involves the use of a catalyst such as p-toluenesulfonic acid and occurs in a polar solvent like acetonitrile. The reaction yields 5,10,15,20-tetra(4-pyridinyl)porphine with a yield of approximately 50-60%.

About

CAS No 16834-13-2
English Name 5,10,15,20-Tetra(4-pyridinyl)porphine
Molecular Formula C40H24N8
Molecular Weight 618.7040000000001 g/mol
SMILES n1ccc(cc1)/C/1=C/2\C=CC(=N2)/C(=c\2/cc/c(=C(/C3=N/C(=C(\c4[nH]c1cc4)/c1ccncc1)/C=C3)\c1ccncc1)/[nH]2)/c1ccncc1
InChIKey BWSWKIKSPYAKAP-SNSPGWSPSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2)?

5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2) is an organic compound known for its deep re...

Compound Q&A

What industries use 5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2)?

5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2) finds applications in various industries. It...

Compound Q&A

What precautions should be taken when handling 5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2)?

When handling 5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2), it is essential to wear appro...

Compound Q&A

What is the market or research trend for N-Methylphenylalanine (CAS: 2566-30-5)?

The market for N-Methylphenylalanine (CAS: 2566-30-5) is growing due to its appl...

2566-30-5N-Methylphenylalanin...
Compound Q&A

What are the main uses of 4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2)?

4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2) is primarily used in pharma...

210488-53-24-[(1R)-1-Aminoethyl...
Compound Q&A

Is 2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CAS: 110925-92-3) safe?

2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CA...

110925-92-32-Hydroxy-N-{3-[3-(1...
Compound Q&A

What are the physical and chemical properties of 2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5)?

2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5) is a white crystalline solid with ...

169508-94-52-(5-Oxazolyl)benzoi...