Compound Q&A

What are the physical and chemical properties of 5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2)?

Answer

5,10,15,20-Tetra(4-pyridinyl)porphine
5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2) is an organic compound known for its deep red crystalline form. It has a molecular weight of approximately 478.34 g/mol and is poorly soluble in water but soluble in organic solvents like dichloromethane and acetonitrile. The compound exhibits strong reactivity with metals and is known for its photophysical and photochemical properties.

About

CAS No 16834-13-2
English Name 5,10,15,20-Tetra(4-pyridinyl)porphine
Molecular Formula C40H24N8
Molecular Weight 618.7040000000001 g/mol
SMILES n1ccc(cc1)/C/1=C/2\C=CC(=N2)/C(=c\2/cc/c(=C(/C3=N/C(=C(\c4[nH]c1cc4)/c1ccncc1)/C=C3)\c1ccncc1)/[nH]2)/c1ccncc1
InChIKey BWSWKIKSPYAKAP-SNSPGWSPSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is 5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2) typically synthesized?

5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2) is typically synthesized by the condensation...

Compound Q&A

What industries use 5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2)?

5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2) finds applications in various industries. It...

Compound Q&A

What precautions should be taken when handling 5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2)?

When handling 5,10,15,20-Tetra(4-pyridinyl)porphine (CAS: 16834-13-2), it is essential to wear appro...

Compound Q&A

What is the market or research trend for N-Methylphenylalanine (CAS: 2566-30-5)?

The market for N-Methylphenylalanine (CAS: 2566-30-5) is growing due to its appl...

2566-30-5N-Methylphenylalanin...
Compound Q&A

What are the main uses of 4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2)?

4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2) is primarily used in pharma...

210488-53-24-[(1R)-1-Aminoethyl...
Compound Q&A

Is 2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CAS: 110925-92-3) safe?

2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CA...

110925-92-32-Hydroxy-N-{3-[3-(1...
Compound Q&A

What are the physical and chemical properties of 2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5)?

2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5) is a white crystalline solid with ...

169508-94-52-(5-Oxazolyl)benzoi...