Compound Q&A

What are the physical and chemical properties of 4-O-beta-D-Galactopyranosyl-D-glucitol hydrate (CAS: 81025-04-9)?

Answer

4-O-beta-D-Galactopyranosyl-D-glucitol hydrate (1:1)
4-O-beta-D-Galactopyranosyl-D-glucitol hydrate (CAS: 81025-04-9) is a crystalline compound with a molecular weight of approximately 460.34 g/mol. It has a melting point of around 200°C and is slightly soluble in water. This compound is reactive, particularly with acids and bases, and is stable under neutral conditions.

About

CAS No 81025-04-9
English Name 4-O-beta-D-Galactopyranosyl-D-glucitol hydrate (1:1)
Molecular Formula C12H26O12
Molecular Weight 362.33 g/mol
SMILES C(C1C(C(C(C(O1)OC(C(CO)O)C(C(CO)O)O)O)O)O)O.O
InChIKey LXMBXZRLTPSWCR-XBLONOLSSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is 4-O-beta-D-Galactopyranosyl-D-glucitol hydrate (CAS: 81025-04-9) typically synthesized?

4-O-beta-D-Galactopyranosyl-D-glucitol hydrate (CAS: 81025-04-9) is synthesized through a glycosylat...

Compound Q&A

What industries use 4-O-beta-D-Galactopyranosyl-D-glucitol hydrate (CAS: 81025-04-9)?

4-O-beta-D-Galactopyranosyl-D-glucitol hydrate (CAS: 81025-04-9) is used primarily in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 4-O-beta-D-Galactopyranosyl-D-glucitol hydrate (CAS: 81025-04-9)?

When handling 4-O-beta-D-Galactopyranosyl-D-glucitol hydrate (CAS: 81025-04-9), it is recommended to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...