Compound Q&A

What are the physical and chemical properties of 3-Bromo-4-fluorocinnamic acid (CAS: 160434-49-1)?

Answer

3-Bromo-4-fluorocinnamic acid
3-Bromo-4-fluorocinnamic acid is a white crystalline solid with a molecular weight of 253.03 g/mol. It has a pKa of approximately 3.2 and a melting point of 146-148°C. The compound is soluble in water and organic solvents such as ethanol and acetone. It is moderately reactive with basic compounds and can undergo substitution and condensation reactions.

About

English Name 3-Bromo-4-fluorocinnamic acid
Molecular Formula C9H6BrFO2
Molecular Weight 245.05 g/mol
SMILES C1=CC(=C(C=C1C=CC(=O)O)Br)F
InChIKey ZNIGVADAKXOMQH-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is 3-Bromo-4-fluorocinnamic acid (CAS: 160434-49-1) typically synthesized?

3-Bromo-4-fluorocinnamic acid is synthesized via the bromination of 4-fluorocinnamic acid followed b...

Compound Q&A

What industries use 3-Bromo-4-fluorocinnamic acid (CAS: 160434-49-1)?

3-Bromo-4-fluorocinnamic acid is used in the pharmaceutical and chemical industries for the synthesi...

Compound Q&A

What precautions should be taken when handling 3-Bromo-4-fluorocinnamic acid (CAS: 160434-49-1)?

When handling 3-Bromo-4-fluorocinnamic acid, it is important to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...