Compound Q&A

How is Cyclohexyl p-toluenesulfonate (CAS: 953-91-3) typically synthesized?

Answer

Cyclohexyl p-toluenesulfonate
Cyclohexyl p-toluenesulfonate is typically synthesized by the sulfonation of p-toluenesulfonic acid with cyclohexanol. The process involves the use of a sulfuric acid catalyst and takes place at a temperature of around 120°C. High selectivity and yield are achieved under these conditions.

About

CAS No 953-91-3
English Name Cyclohexyl p-toluenesulfonate
Molecular Formula C13H18O3S
Molecular Weight 254.35 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OC2CCCCC2
InChIKey OHHPZPDQZMUTCA-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cyclohexyl p-toluenesulfonate (CAS: 953-91-3)?

Cyclohexyl p-toluenesulfonate (CAS: 953-91-3) is a white crystalline solid with a molecular weight o...

Compound Q&A

What industries use Cyclohexyl p-toluenesulfonate (CAS: 953-91-3)?

Cyclohexyl p-toluenesulfonate (CAS: 953-91-3) is primarily used in the pharmaceutical and polymer in...

Compound Q&A

What precautions should be taken when handling Cyclohexyl p-toluenesulfonate (CAS: 953-91-3)?

When handling Cyclohexyl p-toluenesulfonate (CAS: 953-91-3), appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...