Compound Q&A

What are the physical and chemical properties of 2,2-Dimethyl-1,3-propanediyl bis(2-methylacrylate) (CAS: 1985-51-9)?

Answer

2,2-Dimethyl-1,3-propanediyl bis(2-methylacrylate)
2,2-Dimethyl-1,3-propanediyl bis(2-methylacrylate) (CAS: 1985-51-9) is a colorless to light yellow liquid with a molecular weight of approximately 234.33 g/mol. It is moderately soluble in common organic solvents and exhibits good reactivity towards free radical polymerization. It crystallizes at low temperatures and has a favorable melting point of 13-14°C. The compound is also known for its stability under normal conditions but can undergo degradation upon prolonged exposure to heat or light.

About

CAS No 1985-51-9
English Name 2,2-Dimethyl-1,3-propanediyl bis(2-methylacrylate)
Molecular Formula C13H20O4
Molecular Weight 240.3 g/mol
SMILES CC(=C)C(=O)OCC(C)(C)COC(=O)C(=C)C
InChIKey ULQMPOIOSDXIGC-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is 2,2-Dimethyl-1,3-propanediyl bis(2-methylacrylate) (CAS: 1985-51-9) typically synthesized?

2,2-Dimethyl-1,3-propanediyl bis(2-methylacrylate) (CAS: 1985-51-9) is synthesized through a multist...

Compound Q&A

What industries use 2,2-Dimethyl-1,3-propanediyl bis(2-methylacrylate) (CAS: 1985-51-9)?

2,2-Dimethyl-1,3-propanediyl bis(2-methylacrylate) (CAS: 1985-51-9) is widely used in the polymer in...

Compound Q&A

What precautions should be taken when handling 2,2-Dimethyl-1,3-propanediyl bis(2-methylacrylate) (CAS: 1985-51-9)?

When handling 2,2-Dimethyl-1,3-propanediyl bis(2-methylacrylate) (CAS: 1985-51-9), it is crucial to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...