Compound Q&A

What are the physical and chemical properties of 3-[Dimethoxy(methyl)silyl]propyl acrylate (CAS: 13732-00-8)?

Answer

3-[Dimethoxy(methyl)silyl]propyl acrylate
3-[Dimethoxy(methyl)silyl]propyl acrylate (CAS: 13732-00-8) is a colorless liquid with a slightly pungent odor. It has a molecular weight of approximately 238.3 g/mol and a boiling point around 109°C. This compound is poorly soluble in water but miscible with most organic solvents. It is highly reactive, especially towards nucleophiles and bases, and can undergo polymerization reactions under suitable conditions.

About

CAS No 13732-00-8
English Name 3-[Dimethoxy(methyl)silyl]propyl acrylate
Molecular Formula C9H18O4Si
Molecular Weight 218.33 g/mol
SMILES CO[Si](C)(CCCOC(=O)C=C)OC
InChIKey MCDBEBOBROAQSH-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is 3-[Dimethoxy(methyl)silyl]propyl acrylate (CAS: 13732-00-8) typically synthesized?

3-[Dimethoxy(methyl)silyl]propyl acrylate is typically synthesized via the esterification of acryloy...

Compound Q&A

What industries use 3-[Dimethoxy(methyl)silyl]propyl acrylate (CAS: 13732-00-8)?

3-[Dimethoxy(methyl)silyl]propyl acrylate (CAS: 13732-00-8) is widely used in the pharmaceuticals in...

Compound Q&A

What precautions should be taken when handling 3-[Dimethoxy(methyl)silyl]propyl acrylate (CAS: 13732-00-8)?

When handling 3-[Dimethoxy(methyl)silyl]propyl acrylate (CAS: 13732-00-8), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...