Compound Q&A

What precautions should be taken when handling (2R)-2-(2,4-Dichlorophenoxy)propanoic acid (CAS: 15165-67-0)?

Answer

(2R)-2-(2,4-Dichlorophenoxy)propanoic acid
When handling (2R)-2-(2,4-Dichlorophenoxy)propanoic acid, it is essential to use appropriate personal protective equipment (PPE), including gloves and goggles. Work in a well-ventilated area or a fume hood. Spills should be cleaned up with caution, and an SDS (Safety Data Sheet) should be consulted for detailed safety information.

About

CAS No 15165-67-0
English Name (2R)-2-(2,4-Dichlorophenoxy)propanoic acid
Molecular Formula C9H8Cl2O3
Molecular Weight 235.07 g/mol
SMILES CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl
InChIKey MZHCENGPTKEIGP-RXMQYKEDSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-(2,4-Dichlorophenoxy)propanoic acid (CAS: 15165-67-0)?

(2R)-2-(2,4-Dichlorophenoxy)propanoic acid is a white crystalline solid with a molecular weight of 2...

Compound Q&A

How is (2R)-2-(2,4-Dichlorophenoxy)propanoic acid (CAS: 15165-67-0) typically synthesized?

(2R)-2-(2,4-Dichlorophenoxy)propanoic acid can be synthesized through a two-step process. First, 2,4...

Compound Q&A

What industries use (2R)-2-(2,4-Dichlorophenoxy)propanoic acid (CAS: 15165-67-0)?

(2R)-2-(2,4-Dichlorophenoxy)propanoic acid is used in the pharmaceutical and agricultural industries...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...