Compound Q&A

What industries use N-[2-(1H-Imidazol-4-yl)ethyl]-beta-alaninamide dihydrochloride (CAS: 57022-38-5)?

Answer

N-[2-(1H-Imidazol-4-yl)ethyl]-beta-alaninamide dihydrochloride
N-[2-(1H-Imidazol-4-yl)ethyl]-beta-alaninamide dihydrochloride (CAS: 57022-38-5) finds uses in the pharmaceutical industry, where it is used as a precursor in the synthesis of certain drugs. It also has applications in the development of sensors and in the production of semiconductors, owing to its specific functional groups and chemical properties.

About

CAS No 57022-38-5
English Name N-[2-(1H-Imidazol-4-yl)ethyl]-beta-alaninamide dihydrochloride
Molecular Formula C8H16Cl2N4O
Molecular Weight 255.15 g/mol
SMILES Cl.Cl.NCCC(=O)NCCC1=CN=CN1
InChIKey ZQTUNIWBUQUKAM-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[2-(1H-Imidazol-4-yl)ethyl]-beta-alaninamide dihydrochloride (CAS: 57022-38-5)?

N-[2-(1H-Imidazol-4-yl)ethyl]-beta-alaninamide dihydrochloride (CAS: 57022-38-5) is a white or off-w...

Compound Q&A

How is N-[2-(1H-Imidazol-4-yl)ethyl]-beta-alaninamide dihydrochloride (CAS: 57022-38-5) typically synthesized?

N-[2-(1H-Imidazol-4-yl)ethyl]-beta-alaninamide dihydrochloride (CAS: 57022-38-5) is synthesized thro...

Compound Q&A

What precautions should be taken when handling N-[2-(1H-Imidazol-4-yl)ethyl]-beta-alaninamide dihydrochloride (CAS: 57022-38-5)?

When handling N-[2-(1H-Imidazol-4-yl)ethyl]-beta-alaninamide dihydrochloride (CAS: 57022-38-5), it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...