Compound Q&A

How is (2,2-Dimethyl-1,3-propanediyl)bis(oxy-3,1-propanediyl) bisacrylate (CAS: 84170-74-1) typically synthesized?

Answer

(2,2-Dimethyl-1,3-propanediyl)bis(oxy-3,1-propanediyl) bisacrylate
It is typically synthesized through a condensation reaction of diacrylates with diols. The process involves the use of a catalyst such as dibutyltin dilaurate to enhance the reaction rate and selectivity, leading to high yields of the desired product.

About

CAS No 84170-74-1
English Name (2,2-Dimethyl-1,3-propanediyl)bis(oxy-3,1-propanediyl) bisacrylate
Molecular Formula C17H28O6
Molecular Weight 328.41 g/mol
SMILES CC(C)(COCCCOC(=O)C=C)COCCCOC(=O)C=C
InChIKey NQGDHQASSFDDLD-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2,2-Dimethyl-1,3-propanediyl)bis(oxy-3,1-propanediyl) bisacrylate (CAS: 84170-74-1)?

This compound is an acrylate ester with a low molecular weight and is moderately soluble in common o...

Compound Q&A

What industries use (2,2-Dimethyl-1,3-propanediyl)bis(oxy-3,1-propanediyl) bisacrylate (CAS: 84170-74-1)?

This compound is widely used in the polymer industry for the production of polyacrylates. It also fi...

Compound Q&A

What precautions should be taken when handling (2,2-Dimethyl-1,3-propanediyl)bis(oxy-3,1-propanediyl) bisacrylate (CAS: 84170-74-1)?

Handle in a well-ventilated area or fume hood. Use personal protective equipment such as gloves and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...