Compound Q&A

How is 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-beta-D-glucopyranosyl-beta-D-galactopyranoside (CAS: 31512-06-8) typically synthesized?

Answer

5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-beta-D-glucopyranosyl-beta-D-galactopyranoside
This compound is usually synthesized through a multistep process involving the synthesis of the aglycone, followed by glycosylation. Common methods include the use of protective groups, condensation reactions, and the application of catalysts. The overall synthesis yields are moderate, and the method involves careful control of pH and temperature to ensure selectivity and purity.

About

CAS No 31512-06-8
English Name 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-beta-D-glucopyranosyl-beta-D-galactopyranoside
Molecular Formula C27H30O16
Molecular Weight 610.52 g/mol
SMILES OCC1O[C@@H](OC2C(O)[C@@H](O)C(CO)O[C@H]2OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)[C@H](O)C(O)[C@@H]1O
InChIKey LKZDFKLGDGSGEO-PABQPRPFSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-beta-D-glucopyranosyl-beta-D-galactopyranoside (CAS: 31512-06-8)?

This compound is a dihydroxyflavone glycoside. It is a white to off-white crystalline solid with a m...

Compound Q&A

What industries use 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-beta-D-glucopyranosyl-beta-D-galactopyranoside (CAS: 31512-06-8)?

This compound is used in the pharmaceutical industry for its antioxidant and anti-inflammatory prope...

Compound Q&A

What precautions should be taken when handling 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-beta-D-glucopyranosyl-beta-D-galactopyranoside (CAS: 31512-06-8)?

When handling this compound, safety goggles and gloves are essential to prevent contact with the ski...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...