Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-diphenyldisiloxane (CAS: 56-33-7) typically synthesized?

Answer

1,1,3,3-Tetramethyl-1,3-diphenyldisiloxane
1,1,3,3-Tetramethyl-1,3-diphenyldisiloxane (CAS: 56-33-7) is typically synthesized via the condensation of diphenyldichlorosilane with tetramethyldisiloxane, mediated by a base such as sodium hydride. The reaction involves the formation of a complex intermediate, followed by elimination of hydrogen chloride to yield the final product.

About

CAS No 56-33-7
English Name 1,1,3,3-Tetramethyl-1,3-diphenyldisiloxane
Molecular Formula C16H22OSi2
Molecular Weight 286.52 g/mol
SMILES C[Si](C)(C1=CC=CC=C1)O[Si](C)(C)C2=CC=CC=C2
InChIKey YQJPWWLJDNCSCN-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1,3,3-Tetramethyl-1,3-diphenyldisiloxane (CAS: 56-33-7)?

1,1,3,3-Tetramethyl-1,3-diphenyldisiloxane (CAS: 56-33-7) is a colorless liquid with a high molecula...

Compound Q&A

What industries use 1,1,3,3-Tetramethyl-1,3-diphenyldisiloxane (CAS: 56-33-7)?

1,1,3,3-Tetramethyl-1,3-diphenyldisiloxane (CAS: 56-33-7) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 1,1,3,3-Tetramethyl-1,3-diphenyldisiloxane (CAS: 56-33-7)?

When handling 1,1,3,3-Tetramethyl-1,3-diphenyldisiloxane (CAS: 56-33-7), wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...