Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-4-(trifluoromethyl)pyridine (CAS: 39890-98-7)?

Answer

2,6-Dichloro-4-(trifluoromethyl)pyridine
Handling 2,6-Dichloro-4-(trifluoromethyl)pyridine requires strict safety measures due to its potential health hazards and reactivity. Wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work in a well-ventilated fume hood to minimize exposure. Spills should be dealt with using appropriate absorbent materials and the incident should be reported to the safety officer. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 39890-98-7
English Name 2,6-Dichloro-4-(trifluoromethyl)pyridine
Molecular Formula C6H2Cl2F3N
Molecular Weight 215.99 g/mol
SMILES C1=C(C=C(N=C1Cl)Cl)C(F)(F)F
InChIKey KVNQWVYYVLCZKK-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-4-(trifluoromethyl)pyridine (CAS: 39890-98-7)?

2,6-Dichloro-4-(trifluoromethyl)pyridine is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 2,6-Dichloro-4-(trifluoromethyl)pyridine (CAS: 39890-98-7) typically synthesized?

2,6-Dichloro-4-(trifluoromethyl)pyridine is typically synthesized via the Friedel-Crafts alkylation ...

Compound Q&A

What industries use 2,6-Dichloro-4-(trifluoromethyl)pyridine (CAS: 39890-98-7)?

2,6-Dichloro-4-(trifluoromethyl)pyridine is used primarily in the pharmaceutical industry as an inte...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...