Compound Q&A

What are the physical and chemical properties of Netobimin (CAS: 88255-01-0)?

Answer

Netobimin
Netobimin is a crystalline compound with a molecular weight of approximately 225.24 g/mol. It has a high solubility in organic solvents like ethanol and methanol but is insoluble in water. Chemically, it is relatively stable under normal conditions but can react with strong acids and bases. It is used in various applications due to its unique reactivity and stability.

About

CAS No 88255-01-0
English Name Netobimin
Molecular Formula C14H20N4O7S2
Molecular Weight 420.46 g/mol
SMILES CCCSC1=CC(=C(C=C1)[N+](=O)[O-])NC(=NCCS(=O)(=O)O)NC(=O)OC
InChIKey WCBVUETZRWGIJQ-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is Netobimin (CAS: 88255-01-0) typically synthesized?

Netobimin is synthesized through a multi-step process involving the condensation of an aromatic amin...

Compound Q&A

What industries use Netobimin (CAS: 88255-01-0)?

Netobimin is primarily used in the pharmaceutical industry for the synthesis of new drugs, particula...

Compound Q&A

What precautions should be taken when handling Netobimin (CAS: 88255-01-0)?

When handling Netobimin, it is essential to wear appropriate personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...