Compound Q&A

What are the physical and chemical properties of 5-[(2S)-5,7-Dihydroxy-4-oxo-3,4-dihydro-2H-chromen-2-yl]-2,3-dihydroxyphenyl beta-D-glucopyranoside (CAS: 78708-33-5)?

Answer

5-[(2S)-5,7-Dihydroxy-4-oxo-3,4-dihydro-2H-chromen-2-yl]-2,3-dihydroxyphenyl beta-D-glucopyranoside
This compound is a glucopyranoside derivative with a chromene structure. It crystallizes as a white solid with a molecular weight of approximately 606.5 g/mol. It is soluble in ethanol and methanol but less soluble in water. Chemically, it exhibits reactivity typical of phenol and sugar derivatives, making it susceptible to hydrolysis and oxidation.

About

CAS No 78708-33-5
English Name 5-[(2S)-5,7-Dihydroxy-4-oxo-3,4-dihydro-2H-chromen-2-yl]-2,3-dihydroxyphenyl beta-D-glucopyranoside
Molecular Formula C21H22O12
Molecular Weight 466.4 g/mol
SMILES C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C(=C3)OC4C(C(C(C(O4)CO)O)O)O)O)O
InChIKey SNFFBROYEDWRGB-NHXQFOETSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is 5-[(2S)-5,7-Dihydroxy-4-oxo-3,4-dihydro-2H-chromen-2-yl]-2,3-dihydroxyphenyl beta-D-glucopyranoside (CAS: 78708-33-5) typically synthesized?

This compound can be synthesized via a multi-step process involving condensation of 2,3-dihydroxyphe...

Compound Q&A

What industries use 5-[(2S)-5,7-Dihydroxy-4-oxo-3,4-dihydro-2H-chromen-2-yl]-2,3-dihydroxyphenyl beta-D-glucopyranoside (CAS: 78708-33-5)?

This compound is used in pharmaceutical applications, where it may serve as a precursor for drug dev...

Compound Q&A

What precautions should be taken when handling 5-[(2S)-5,7-Dihydroxy-4-oxo-3,4-dihydro-2H-chromen-2-yl]-2,3-dihydroxyphenyl beta-D-glucopyranoside (CAS: 78708-33-5)?

When handling this compound, use personal protective equipment such as gloves, goggles, and a lab co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...