Compound Q&A

How is S-(Thiobenzoyl)thioglycolic acid (CAS: 942-91-6) typically synthesized?

Answer

S-(Thiobenzoyl)thioglycolic acid
S-(Thiobenzoyl)thioglycolic acid is typically synthesized through the condensation of thioglycolic acid with benzoic anhydride in the presence of a catalyst such as pyridine. The reaction proceeds with high selectivity and yields the desired product in good purity.

About

CAS No 942-91-6
English Name S-(Thiobenzoyl)thioglycolic acid
Molecular Formula C9H8O2S2
Molecular Weight 212.3 g/mol
SMILES C1=CC=C(C=C1)C(=S)SCC(=O)O
InChIKey XBEIANFIOZTEDE-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of S-(Thiobenzoyl)thioglycolic acid (CAS: 942-91-6)?

S-(Thiobenzoyl)thioglycolic acid (CAS: 942-91-6) is a crystalline compound with a molecular weight o...

Compound Q&A

What industries use S-(Thiobenzoyl)thioglycolic acid (CAS: 942-91-6)?

S-(Thiobenzoyl)thioglycolic acid (CAS: 942-91-6) is used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling S-(Thiobenzoyl)thioglycolic acid (CAS: 942-91-6)?

When handling S-(Thiobenzoyl)thioglycolic acid (CAS: 942-91-6), it is important to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...