Compound Q&A

What are the physical and chemical properties of 6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione (CAS: 4743-17-3)?

Answer

6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione
6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione is a crystalline solid with a molecular weight of approximately 216.01 g/mol. It has limited water solubility and is generally soluble in organic solvents like ethanol and acetone. The compound exhibits moderate acidity and can undergo reactions such as nucleophilic substitution and electrophilic aromatic substitution. It is stable under normal conditions but requires attention to avoid prolonged exposure to strong bases or reducing agents.

About

CAS No 4743-17-3
English Name 6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione
Molecular Formula C8H4ClNO3
Molecular Weight 197.57699999999997 g/mol
SMILES C1=CC2=C(C=C1Cl)C(=O)OC(=O)N2
InChIKey MYQFJMYJVJRSGP-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione (CAS: 4743-17-3) typically synthesized?

6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione can be synthesized through the condensation of 2-chloro-3,...

Compound Q&A

What industries use 6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione (CAS: 4743-17-3)?

6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione is used in various industries. It is a key intermediate in...

Compound Q&A

What precautions should be taken when handling 6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione (CAS: 4743-17-3)?

When handling 6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione, it is important to wear appropriate persona...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...