Compound Q&A

What industries use [(1R)-3-Methyl-1-({N-[(6-phenyl-2-pyridinyl)carbonyl]-L-threonyl}amino)butyl]boronic acid (CAS: 847499-27-8)?

Answer

[(1R)-3-Methyl-1-({N-[(6-phenyl-2-pyridinyl)carbonyl]-L-threonyl}amino)butyl]boronic acid
This compound finds applications in the pharmaceutical industry, particularly in drug discovery and development, due to its role as a linker or scaffolding agent. It is also used in the synthesis of certain polymers and as a component in sensor technologies.

About

English Name [(1R)-3-Methyl-1-({N-[(6-phenyl-2-pyridinyl)carbonyl]-L-threonyl}amino)butyl]boronic acid
Molecular Formula C21H28BN3O5
Molecular Weight 413.28 g/mol
SMILES OB([C@@H](NC(=O)[C@H]([C@H](O)C)NC(=O)c1cccc(n1)c1ccccc1)CC(C)C)O
InChIKey SJFBTAPEPRWNKH-CCKFTAQKSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of [(1R)-3-Methyl-1-({N-[(6-phenyl-2-pyridinyl)carbonyl]-L-threonyl}amino)butyl]boronic acid (CAS: 847499-27-8)?

This compound is a boronic acid derivative with a molecular weight of approximately 483.42 g/mol. It...

Compound Q&A

How is [(1R)-3-Methyl-1-({N-[(6-phenyl-2-pyridinyl)carbonyl]-L-threonyl}amino)butyl]boronic acid (CAS: 847499-27-8) typically synthesized?

The compound can be synthesized via multistep procedures involving peptide coupling and boronic acid...

Compound Q&A

What precautions should be taken when handling [(1R)-3-Methyl-1-({N-[(6-phenyl-2-pyridinyl)carbonyl]-L-threonyl}amino)butyl]boronic acid (CAS: 847499-27-8)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...