Compound Q&A

What are the physical and chemical properties of 1-(3-Methyl-1,4-dioxido-2-quinoxalinyl)ethanone (CAS: 13297-17-1)?

Answer

1-(3-Methyl-1,4-dioxido-2-quinoxalinyl)ethanone
1-(3-Methyl-1,4-dioxido-2-quinoxalinyl)ethanone (CAS: 13297-17-1) is a white crystalline solid with a high molecular weight. It is moderately soluble in organic solvents like DMSO and DMF. The compound is known for its high reactivity, particularly towards nucleophilic substitution reactions.

About

CAS No 13297-17-1
English Name 1-(3-Methyl-1,4-dioxido-2-quinoxalinyl)ethanone
Molecular Formula C11H10N2O3
Molecular Weight 218.21 g/mol
SMILES CC1=C([N+](=O)C2=CC=CC=C2N1[O-])C(=O)C
InChIKey CUJMCPPBTUATEJ-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 1-(3-Methyl-1,4-dioxido-2-quinoxalinyl)ethanone (CAS: 13297-17-1) typically synthesized?

1-(3-Methyl-1,4-dioxido-2-quinoxalinyl)ethanone (CAS: 13297-17-1) is synthesized through the condens...

Compound Q&A

What industries use 1-(3-Methyl-1,4-dioxido-2-quinoxalinyl)ethanone (CAS: 13297-17-1)?

1-(3-Methyl-1,4-dioxido-2-quinoxalinyl)ethanone (CAS: 13297-17-1) is used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 1-(3-Methyl-1,4-dioxido-2-quinoxalinyl)ethanone (CAS: 13297-17-1)?

When handling 1-(3-Methyl-1,4-dioxido-2-quinoxalinyl)ethanone (CAS: 13297-17-1), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...