Compound Q&A

What industries use (Z)-2,3-Dimercapto-2-butenedinitrile disodium salt (CAS: 5466-54-6)?

Answer

(Z)-2,3-Dimercapto-2-butenedinitrile disodium salt
(Z)-2,3-Dimercapto-2-butenedinitrile disodium salt is used in the pharmaceutical industry for its thiol functionality, which can be used in drug synthesis. It also finds applications in the polymer industry for its thiol-ene reaction capability. Additionally, it is utilized in the semiconductor industry for its role in chemical vapor deposition processes and as a chemical sensor material.

About

CAS No 5466-54-6
English Name (Z)-2,3-Dimercapto-2-butenedinitrile disodium salt
Molecular Formula C4H2N2Na2S2
Molecular Weight 188.2 g/mol
SMILES C(#N)C(=C(C#N)S)S.[Na].[Na]
InChIKey VRXXGEDHLLZAIP-GSBNXNDCSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (Z)-2,3-Dimercapto-2-butenedinitrile disodium salt (CAS: 5466-54-6)?

(Z)-2,3-Dimercapto-2-butenedinitrile disodium salt is a yellow crystalline solid with a molecular we...

Compound Q&A

How is (Z)-2,3-Dimercapto-2-butenedinitrile disodium salt (CAS: 5466-54-6) typically synthesized?

(Z)-2,3-Dimercapto-2-butenedinitrile disodium salt can be synthesized through the reaction of sodium...

Compound Q&A

What precautions should be taken when handling (Z)-2,3-Dimercapto-2-butenedinitrile disodium salt (CAS: 5466-54-6)?

When handling (Z)-2,3-Dimercapto-2-butenedinitrile disodium salt, use personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...