Compound Q&A

What precautions should be taken when handling [9,10-Di(2-naphthyl)-2-anthryl]boronic acid (CAS: 867044-28-8)?

Answer

[9,10-Di(2-naphthyl)-2-anthryl]boronic acid
When handling [9,10-Di(2-naphthyl)-2-anthryl]boronic acid (CAS: 867044-28-8), wear appropriate personal protective equipment (PPE) including gloves and safety goggles. The compound should be stored in a cool, dry place, away from sources of ignition. In case of a spill, use appropriate absorbent material and dispose of it according to local regulations. Refer to the safety data sheet (SDS) for detailed safety information.

About

English Name [9,10-Di(2-naphthyl)-2-anthryl]boronic acid
Molecular Formula C34H23BO2
Molecular Weight 474.37 g/mol
SMILES OB(O)C1=CC2=C(C=C1)C(C1=CC3=C(C=CC=C3)C=C1)=C1C=CC=CC1=C2C1=CC2=C(C=CC=C2)C=C1
InChIKey NVPJWLBDGLWXCH-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of [9,10-Di(2-naphthyl)-2-anthryl]boronic acid (CAS: 867044-28-8)?

The compound [9,10-Di(2-naphthyl)-2-anthryl]boronic acid (CAS: 867044-28-8) is a crystalline solid w...

Compound Q&A

How is [9,10-Di(2-naphthyl)-2-anthryl]boronic acid (CAS: 867044-28-8) typically synthesized?

[9,10-Di(2-naphthyl)-2-anthryl]boronic acid (CAS: 867044-28-8) is synthesized by the condensation of...

Compound Q&A

What industries use [9,10-Di(2-naphthyl)-2-anthryl]boronic acid (CAS: 867044-28-8)?

[9,10-Di(2-naphthyl)-2-anthryl]boronic acid (CAS: 867044-28-8) is primarily used in the pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...