Compound Q&A

What are the physical and chemical properties of Methyl 4-chloro-2-hydroxybenzoate (CAS: 22717-55-1)?

Answer

Methyl 4-chloro-2-hydroxybenzoate
Methyl 4-chloro-2-hydroxybenzoate (CAS: 22717-55-1) is a crystalline solid with a molecular weight of approximately 214.01 g/mol. It has a melting point of 89-91°C and is only slightly soluble in water. It is reactive towards bases and can undergo hydrolysis. It is also sensitive to light and air, leading to decomposition.

About

CAS No 22717-55-1
English Name Methyl 4-chloro-2-hydroxybenzoate
Molecular Formula C8H7ClO3
Molecular Weight 186.59 g/mol
SMILES COC(=O)C1=C(C=C(C=C1)Cl)O
InChIKey QXDWMJQRXWLSDP-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is Methyl 4-chloro-2-hydroxybenzoate (CAS: 22717-55-1) typically synthesized?

Methyl 4-chloro-2-hydroxybenzoate (CAS: 22717-55-1) is typically synthesized by the esterification o...

Compound Q&A

What industries use Methyl 4-chloro-2-hydroxybenzoate (CAS: 22717-55-1)?

Methyl 4-chloro-2-hydroxybenzoate (CAS: 22717-55-1) is used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling Methyl 4-chloro-2-hydroxybenzoate (CAS: 22717-55-1)?

When handling Methyl 4-chloro-2-hydroxybenzoate (CAS: 22717-55-1), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...