Compound Q&A

What industries use Benzyl 4-oxo-1-azepanecarboxylate (CAS: 83621-33-4)?

Answer

Benzyl 4-oxo-1-azepanecarboxylate
Benzyl 4-oxo-1-azepanecarboxylate (CAS: 83621-33-4) is primarily used in the pharmaceutical and polymer industries. It serves as a precursor for the synthesis of various drugs and is also utilized in the formulation of advanced polymers due to its unique chemical properties, such as its ability to form stable complexes and improve material characteristics.

About

CAS No 83621-33-4
English Name Benzyl 4-oxo-1-azepanecarboxylate
Molecular Formula C14H17NO3
Molecular Weight 247.29 g/mol
SMILES C1CC(=O)CCN(C1)C(=O)OCC2=CC=CC=C2
InChIKey ORJQXZSDLARZBC-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 4-oxo-1-azepanecarboxylate (CAS: 83621-33-4)?

Benzyl 4-oxo-1-azepanecarboxylate (CAS: 83621-33-4) is a white crystalline solid with a high molecul...

Compound Q&A

How is Benzyl 4-oxo-1-azepanecarboxylate (CAS: 83621-33-4) typically synthesized?

Benzyl 4-oxo-1-azepanecarboxylate (CAS: 83621-33-4) can be synthesized via a multi-step reaction inv...

Compound Q&A

What precautions should be taken when handling Benzyl 4-oxo-1-azepanecarboxylate (CAS: 83621-33-4)?

When handling Benzyl 4-oxo-1-azepanecarboxylate (CAS: 83621-33-4), it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...