Compound Q&A

How is 4,5,6,7-Tetrachloro-1H-isoindole-1,3(2H)-dione (CAS: 1571-13-7) typically synthesized?

Answer

4,5,6,7-Tetrachloro-1H-isoindole-1,3(2H)-dione
4,5,6,7-Tetrachloro-1H-isoindole-1,3(2H)-dione is usually synthesized via electrophilic aromatic substitution reactions. The key steps involve the halogenation of an appropriate precursor under basic conditions, followed by further transformations such as oxidation. This process often requires the use of Lewis acids and strong bases as catalysts, and the yield can be increased through careful reaction optimization.

About

CAS No 1571-13-7
English Name 4,5,6,7-Tetrachloro-1H-isoindole-1,3(2H)-dione
Molecular Formula C8HCl4NO2
Molecular Weight 284.91 g/mol
SMILES C12=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=O)NC2=O
InChIKey LPUUYZVKCMCHLO-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5,6,7-Tetrachloro-1H-isoindole-1,3(2H)-dione (CAS: 1571-13-7)?

4,5,6,7-Tetrachloro-1H-isoindole-1,3(2H)-dione is a crystalline solid with a high melting point. Its...

Compound Q&A

What industries use 4,5,6,7-Tetrachloro-1H-isoindole-1,3(2H)-dione (CAS: 1571-13-7)?

4,5,6,7-Tetrachloro-1H-isoindole-1,3(2H)-dione is primarily used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 4,5,6,7-Tetrachloro-1H-isoindole-1,3(2H)-dione (CAS: 1571-13-7)?

When handling 4,5,6,7-Tetrachloro-1H-isoindole-1,3(2H)-dione, it is crucial to use personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...