Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 236406-55-6)?

Answer

2-Methyl-2-propanyl 2,7-diazaspiro[3.5]nonane-2-carboxylate
2-Methyl-2-propanyl 2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 236406-55-6) is a crystalline compound with a molecular weight of approximately 222.3 g/mol. It has a low solubility in water but good solubility in organic solvents like methanol and dichloromethane. The compound is moderately reactive, particularly towards nucleophiles and can undergo ester hydrolysis under acidic conditions. It exists as a single crystalline form under standard conditions.

About

English Name 2-Methyl-2-propanyl 2,7-diazaspiro[3.5]nonane-2-carboxylate
Molecular Formula C12H22N2O2
Molecular Weight 226.32 g/mol
SMILES CC(C)(C)OC(=O)N1CC2(C1)CCNCC2
InChIKey HWLNKJXLGQVMJH-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 236406-55-6) typically synthesized?

2-Methyl-2-propanyl 2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 236406-55-6) is typically synthesi...

Compound Q&A

What industries use 2-Methyl-2-propanyl 2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 236406-55-6)?

2-Methyl-2-propanyl 2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 236406-55-6) is used in the pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 236406-55-6)?

When handling 2-Methyl-2-propanyl 2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS: 236406-55-6), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...