Compound Q&A

How is Ammonium trifluoromethanesulfonate (CAS: 38542-94-8) typically synthesized?

Answer

Ammonium trifluoromethanesulfonate
Ammonium trifluoromethanesulfonate is typically synthesized by reacting trifluoromethanesulfonyl chloride with ammonia. The reaction is carried out in a polar aprotic solvent under anhydrous conditions. The yield is generally high, and the process is selective and efficient.

About

CAS No 38542-94-8
English Name Ammonium trifluoromethanesulfonate
Molecular Formula CH4F3NO3S
Molecular Weight 167.11 g/mol
SMILES C(F)(F)(F)S(=O)(=O)[O-].[NH4+]
InChIKey BMWDUGHMODRTLU-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ammonium trifluoromethanesulfonate (CAS: 38542-94-8)?

Ammonium trifluoromethanesulfonate (CAS: 38542-94-8) is a colorless crystalline solid with a high mo...

Compound Q&A

What industries use Ammonium trifluoromethanesulfonate (CAS: 38542-94-8)?

Ammonium trifluoromethanesulfonate (CAS: 38542-94-8) is widely used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling Ammonium trifluoromethanesulfonate (CAS: 38542-94-8)?

When handling Ammonium trifluoromethanesulfonate (CAS: 38542-94-8), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...