Compound Q&A

What industries use 2,9-Dibromo-1,10-phenanthroline (CAS: 39069-02-8)?

Answer

2,9-Dibromo-1,10-phenanthroline
2,9-Dibromo-1,10-phenanthroline (CAS: 39069-02-8) is primarily used in the pharmaceutical, analytical chemistry, and environmental monitoring industries. It serves as a ligand in the coordination chemistry of metal ions, which is crucial for developing new drugs, sensors, and reagents. Additionally, it is used in the development of various analytical techniques, such as spectroscopy and chromatography, for the detection and quantification of metal ions.

About

CAS No 39069-02-8
English Name 2,9-Dibromo-1,10-phenanthroline
Molecular Formula C12H6Br2N2
Molecular Weight 338 g/mol
SMILES C1=CC2=C(C3=C1C=CC(=N3)Br)N=C(C=C2)Br
InChIKey QNLGXYVSHITTGT-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,9-Dibromo-1,10-phenanthroline (CAS: 39069-02-8)?

2,9-Dibromo-1,10-phenanthroline (CAS: 39069-02-8) is a dark red crystalline solid with a molecular w...

Compound Q&A

How is 2,9-Dibromo-1,10-phenanthroline (CAS: 39069-02-8) typically synthesized?

2,9-Dibromo-1,10-phenanthroline (CAS: 39069-02-8) is typically synthesized through the bromination o...

Compound Q&A

What precautions should be taken when handling 2,9-Dibromo-1,10-phenanthroline (CAS: 39069-02-8)?

When handling 2,9-Dibromo-1,10-phenanthroline (CAS: 39069-02-8), it is important to use appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...