Compound Q&A

What industries use 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) (CAS: 1002345-50-7)?

Answer

1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate)
1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) is widely used in the pharmaceutical industry for the synthesis of complex organic molecules. It is also utilized in the polymer industry for its catalytic properties, and in electronics for the production of semiconductors and sensors.

About

English Name 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate)
Molecular Formula C27H52B2F8P2
Molecular Weight 610.24 g/mol
SMILES [B-](F)(F)(F)F.[B-](F)(F)(F)F.C1CCC(CC1)[PH+](CCC[PH+](C2CCCCC2)C3CCCCC3)C4CCCCC4
InChIKey XJZAIJGNZUQTAM-UHFFFAOYSA-P
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) (CAS: 1002345-50-7)?

1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) is a crystalline compound with a molecu...

Compound Q&A

How is 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) (CAS: 1002345-50-7) typically synthesized?

1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) is synthesized through the reaction of ...

Compound Q&A

What precautions should be taken when handling 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) (CAS: 1002345-50-7)?

Proper handling of 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) requires the use of ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...