Compound Q&A

How is Benzyl 4-methylene-1-piperidinecarboxylate (CAS: 138163-12-9) typically synthesized?

Answer

Benzyl 4-methylene-1-piperidinecarboxylate
Benzyl 4-methylene-1-piperidinecarboxylate (CAS: 138163-12-9) is typically synthesized through the condensation of benzyl chloroformate with 4-methyl-1-piperidinemethanol. The reaction is usually performed in the presence of a base like triethylamine to promote the formation of the desired ester product. The yield can be improved by using an appropriate catalyst and optimizing reaction conditions.

About

English Name Benzyl 4-methylene-1-piperidinecarboxylate
Molecular Formula C14H17NO2
Molecular Weight 231.3 g/mol
SMILES C=C1CCN(CC1)C(=O)OCC2=CC=CC=C2
InChIKey FQLKVNIQHUASLU-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 4-methylene-1-piperidinecarboxylate (CAS: 138163-12-9)?

Benzyl 4-methylene-1-piperidinecarboxylate (CAS: 138163-12-9) is a crystalline solid with a molecula...

Compound Q&A

What industries use Benzyl 4-methylene-1-piperidinecarboxylate (CAS: 138163-12-9)?

Benzyl 4-methylene-1-piperidinecarboxylate (CAS: 138163-12-9) is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Benzyl 4-methylene-1-piperidinecarboxylate (CAS: 138163-12-9)?

When handling Benzyl 4-methylene-1-piperidinecarboxylate (CAS: 138163-12-9), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...